Acetaminophen Dimer structure
|
Common Name | Acetaminophen Dimer | ||
|---|---|---|---|---|
| CAS Number | 98966-14-4 | Molecular Weight | 300.30900 | |
| Density | 1.379g/cm3 | Boiling Point | 642.2ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.2ºC | |
| Name | N-[3-(5-acetamido-2-hydroxyphenyl)-4-hydroxyphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 642.2ºC at 760 mmHg |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Flash Point | 342.2ºC |
| Exact Mass | 300.11100 |
| PSA | 105.64000 |
| LogP | 3.98060 |
| Index of Refraction | 1.689 |
| InChIKey | PHJCCQZHFLRCAA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(O)c(-c2cc(NC(C)=O)ccc2O)c1 |
| Storage condition | 2-8°C |
|
~48%
Acetaminophen Dimer CAS#:98966-14-4 |
| Literature: Jiang, Qing; Sheng, Wenbing; Tian, Mi; Tang, Jie; Guo, Cancheng European Journal of Organic Chemistry, 2013 , # 10 p. 1861 - 1866 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| DiOH-diAcNH-biphenyl |
| Paracetamol Dimer Impurity |
| 5,5'-diacetamino-2,2'-biphenol |
| Acetaminophen Dimer |
| paracetamol dimer |