Nitroxylol structure
|
Common Name | Nitroxylol | ||
|---|---|---|---|---|
| CAS Number | 99-12-7 | Molecular Weight | 151.16300 | |
| Density | 1.129 g/cm3 | Boiling Point | 273 °C739 mm Hg(lit.) | |
| Molecular Formula | C8H9NO2 | Melting Point | 72-74 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 273°C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
Use of NitroxylolSolubility in Methanol:very faint turbidity |
| Name | 1,3-Dimethyl-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129 g/cm3 |
|---|---|
| Boiling Point | 273 °C739 mm Hg(lit.) |
| Melting Point | 72-74 °C(lit.) |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16300 |
| Flash Point | 273°C |
| Exact Mass | 151.06300 |
| PSA | 45.82000 |
| LogP | 2.73480 |
| Index of Refraction | 1.547 |
| InChIKey | BYFNZOKBMZKTSC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc([N+](=O)[O-])c1 |
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H373 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic;Xn:Harmful; |
| Risk Phrases | R20/21/22;R23/24/25;R33 |
| Safety Phrases | S45-S36/37 |
| RIDADR | UN 3447 6.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2904209090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Preparation of symmetric and asymmetric aromatic azo compounds from aromatic amines or nitro compounds using supported gold catalysts.
Nat. Protoc. 5(3) , 429-38, (2010) This protocol describes the aerobic oxidation of aromatic anilines to aromatic azo compounds using gold (Au) nanoparticles supported on TiO(2) as a catalyst. Yields above 98% are achieved under a few ... |
| MFCD00007269 |
| 1,3-dimethyl-5-nitrobenzene |
| EINECS 202-732-8 |