methyl 2-[4-(5-formylfuran-2-yl)oxyphenyl]acetate structure
|
Common Name | methyl 2-[4-(5-formylfuran-2-yl)oxyphenyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 99834-86-3 | Molecular Weight | 260.24200 | |
| Density | 1.255g/cm3 | Boiling Point | 399.4ºC at 760mmHg | |
| Molecular Formula | C14H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
| Name | methyl 2-[4-(5-formylfuran-2-yl)oxyphenyl]acetate |
|---|
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760mmHg |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24200 |
| Flash Point | 195.3ºC |
| Exact Mass | 260.06800 |
| PSA | 65.74000 |
| LogP | 2.59990 |
| Index of Refraction | 1.566 |
| InChIKey | HVYOAAMXDAPPLF-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc(Oc2ccc(C=O)o2)cc1 |
| HS Code | 2932190090 |
|---|
|
~%
methyl 2-[4-(5-... CAS#:99834-86-3 |
| Literature: Sarma; Krishna; Shridhar; Seshagiri; Taneja Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 11 p. 993 - 995 |
|
~%
methyl 2-[4-(5-... CAS#:99834-86-3 |
| Literature: Sarma; Krishna; Shridhar; Seshagiri; Taneja Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 11 p. 993 - 995 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |