H-Arg-Gly-Asp-OH structure
|
Common Name | H-Arg-Gly-Asp-OH | ||
|---|---|---|---|---|
| CAS Number | 99896-85-2 | Molecular Weight | 346.340 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H22N6O6 | Melting Point | 153-155℃ (ethyl ether ) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of H-Arg-Gly-Asp-OHRGD Trifluoroacetate is a tripeptide that effectively triggers cell adhesion, addresses certain cell lines and elicits specific cell responses; binds to integrins. |
| Name | arg-gly-asp |
|---|---|
| Synonym | More Synonyms |
| Description | RGD Trifluoroacetate is a tripeptide that effectively triggers cell adhesion, addresses certain cell lines and elicits specific cell responses; binds to integrins. |
|---|---|
| Related Catalog | |
| Target |
Integrin[1] |
| In Vitro | RGD Trifluoroacetate is the most effective and most often employed peptide sequence for stimulated cell adhesion on synthetic surfaces. There are 24 integrins binding to ECM molecules in a RGD dependent manner: α3β1, α5β1, α8β1, αIIbβ3, αvβ1, αvβ3, αvβ5, αvβ6, αvβ8, and to some extent α2β1 and α4β1[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 153-155℃ (ethyl ether ) |
| Molecular Formula | C12H22N6O6 |
| Molecular Weight | 346.340 |
| Exact Mass | 346.160095 |
| PSA | 220.72000 |
| LogP | -1.94 |
| Index of Refraction | 1.648 |
| InChIKey | IYMAXBFPHPZYIK-BQBZGAKWSA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| Storage condition | −20°C |
| Water Solubility | Soluble in 0.1N acetic acid at 20mg/ml |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~52%
H-Arg-Gly-Asp-OH CAS#:99896-85-2 |
| Literature: Pharmaceutical Chemistry Journal, , vol. 32, # 12 p. 641 - 645 |
|
~%
H-Arg-Gly-Asp-OH CAS#:99896-85-2 |
| Literature: US2010/98748 A1, ; |
|
~%
H-Arg-Gly-Asp-OH CAS#:99896-85-2 |
| Literature: Pharmaceutical Chemistry Journal, , vol. 32, # 12 p. 641 - 645 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Coculture of dorsal root ganglion neurons and differentiated human corneal stromal stem cells on silk-based scaffolds.
J. Biomed. Mater. Res. A 103 , 3339-48, (2015) Corneal tissue displays the highest peripheral nerve density in the human body. Engineering of biomaterials to promote interactions between neurons and corneal tissue could provide tissue models for n... |
|
|
Inducing cells to disperse nickel nanowires via integrin-mediated responses.
Nanotechnology 26(13) , 135102, (2015) We present non-cytotoxic, magnetic, Arg-Gly-Asp (RGD)-functionalized nickel nanowires (RGD-nanowires) that trigger specific cellular responses via integrin transmembrane receptors, resulting in disper... |
|
|
Improved tumor-targeting MRI contrast agents: Gd(DOTA) conjugates of a cycloalkane-based RGD peptide.
Biochem. Biophys. Res. Commun. 455(3-4) , 246-50, (2014) Two new MRI contrast agents, Gd-DOTA-c(RGD-ACP-K) (1) and Gd-DOTA-c(RGD-ACH-K) (2), which were designed by incorporating aminocyclopentane (ACP)- or aminocyclohexane (ACH)-carboxylic acid into Gd-DOTA... |
| L-Aspartic acid, L-arginylglycyl- |
| F-336 |
| L-Arginylglycyl-L-aspartic acid |
| L-Aspartic acid, N-(diaminomethylene)-L-ornithylglycyl- |
| aspartic acid, N-[2-[[(1Z,2S)-2-amino-5-[(aminoiminomethyl)amino]-1-hydroxypentylidene]amino]-1-hydroxyethylidene]-, (Z)- |
| Arg-Gly-Asp (RGD) |
| arginyl-glycyl-aspartic acid |
| l-arginylglycylaspartic acid |
| RGD |
| Arg-Gly-Asp acetate |
| H2N-RGD-OH |
| N-(Diaminomethylene)-L-ornithylglycyl-L-aspartic acid |
| MFCD00057952 |
| (2S)-2-({N-[(2S)-5-{[amino(iminio)methyl]amino}-2-ammoniopentanoyl]glycyl}amino)butanedioate |
| H-ARG-GLY-ASP-OH |
| Rgd tripeptide sequence |
| RGD (Arg-Gly-Asp) Peptides |
| RGD PEPTIDE (CORE) |
| N-(diaminomethylidene)-L-ornithylglycyl-L-aspartic acid |