7-Ketolithocholic acid structure
|
Common Name | 7-Ketolithocholic acid | ||
|---|---|---|---|---|
| CAS Number | 4651-67-6 | Molecular Weight | 390.556 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 545.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C24H38O4 | Melting Point | 205ºC | |
| MSDS | N/A | Flash Point | 298.0±19.7 °C | |
Use of 7-Ketolithocholic acid7-Ketolithocholic acid (3α-Hydroxy-7-oxo-5β-cholanic acid), a bile acid, can be absorbed and suppresses endogenous bile acid production and biliary cholesterol secretion[1][2]. |
| Name | 7-oxolithocholic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Ketolithocholic acid (3α-Hydroxy-7-oxo-5β-cholanic acid), a bile acid, can be absorbed and suppresses endogenous bile acid production and biliary cholesterol secretion[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Bile acids are main components of mammalian bile. They are steroid carboxylic acids that synthesized from cholesterol in liver tissue[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 545.9±25.0 °C at 760 mmHg |
| Melting Point | 205ºC |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.556 |
| Flash Point | 298.0±19.7 °C |
| Exact Mass | 390.277008 |
| PSA | 74.60000 |
| LogP | 4.25 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | DXOCDBGWDZAYRQ-AURDAFMXSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(=O)CC4CC(O)CCC4(C)C3CCC12C |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cytotoxicity against human HuH7 cells assessed as cell viability at 500 uM after 24 h...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1251410
|
|
Name: Cytotoxicity against human HET-1A cells assessed as cell viability after 24 hrs by MT...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1251409
|
|
Name: Cytotoxicity against human HET-1A cells assessed as cell viability at 500 uM after 24...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1251411
|
| 3-Hydroxy-7-oxocholan-24-oic acid |
| 3α-Hydroxy-7-keto-5β-cholanic Acid |
| EINECS 225-083-2 |
| 3ALPHA-HYDROXY-7-OXO-5BETA-CHOLANIC ACID |
| 4-(3-Hydroxy-10,13-dimethyl-7-oxohexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
| 3α-Hydroxy-7-oxo-5β-cholanic Acid |
| 3a-Hydroxy-7-oxo-5b-cholanic acid |