tert-butyl 4-((5-((5-tert-butyloxazol-2-yl) Methylthio)thiazol-2-yl)carbamoyl)piperidine-1-carboxylate
Modify Date: 2025-08-23 19:17:27
tert-butyl 4-((5-((5-tert-butyloxazol-2-yl) Methylthio)thiazol-2-yl)carbamoyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-((5-((5-tert-butyloxazol-2-yl) Methylthio)thiazol-2-yl)carbamoyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 345629-23-4 | Molecular Weight | 480.64400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-propanyl 4-{[5-({[5-(2-methyl-2-propanyl)-1,3-oxazol-2 -yl]methyl}sulfanyl)-1,3-thiazol-2-yl]carbamoyl}-1-piperidinecarb oxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H32N4O4S2 |
|---|---|
| Molecular Weight | 480.64400 |
| Exact Mass | 480.18600 |
| PSA | 154.59000 |
| LogP | 5.89390 |
| InChIKey | DJKHLSSMJRYOLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ncc(SCc3ncc(C(C)(C)C)o3)s2)CC1 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:345627-80-7|
Name: Antiproliferative effect against human A2780 cell line was determined in a whole cell...
Source: ChEMBL
Target: A2780
External Id: CHEMBL622593
|
|
Name: Percentage of compound bound to serum protein was determined
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL735436
|
|
Name: Kinase Inhibition assay from Article 10.1021/jm0305568: "N-(cycloalkylamino)acyl-2-am...
Source: BindingDB
Target: N/A
External Id: BindingDB_770_1
|
|
Name: In vitro inhibitory concentration required for displacement of [ATP] at 25 uM from Cy...
Source: ChEMBL
Target: G1/S-specific cyclin-E2
External Id: CHEMBL657126
|
Total 4, Current Page 1 of 1
1
| tert-butyl 4-oxo-1,4'-bipiperidine-1'-carboxylate |