1-Deacetylnimbolinin B structure
|
Common Name | 1-Deacetylnimbolinin B | ||
|---|---|---|---|---|
| CAS Number | 76689-98-0 | Molecular Weight | 584.697 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 665.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C33H44O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.2±31.5 °C | |
Use of 1-Deacetylnimbolinin B1-Deacetylnimbolinin B is a nimbolinin-type limonoid isolated from the fruits of Melia toosendan. Limonoids are a class of highly oxygenated nortriterpenoids that exhibit insecticidal, antifungal, nematicidal and cytotoxic properties[1]. |
| Name | (2R,3aS,5R,6aR,6bR,7S,9R,9aR,11aR,11bR,12S,12aR)-9-Acetoxy-2-(3-furyl)-5,7-dihydroxy-1,6b,9a,12a-tetramethyl-3,3a,6,6a,6b,7,8,9,9a,10,11a,11b,12,12a-tetradecahydro-2H,5H-cyclopenta[b]furo[2',3',4':4,5]naphtho[2,1-d]oxepin-12-yl (2E)-2-methyl-2-butenoate |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Deacetylnimbolinin B is a nimbolinin-type limonoid isolated from the fruits of Melia toosendan. Limonoids are a class of highly oxygenated nortriterpenoids that exhibit insecticidal, antifungal, nematicidal and cytotoxic properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 665.4±55.0 °C at 760 mmHg |
| Molecular Formula | C33H44O9 |
| Molecular Weight | 584.697 |
| Flash Point | 356.2±31.5 °C |
| Exact Mass | 584.298523 |
| PSA | 124.66000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | YOBMBNWOJMLHDF-PXNMLYILSA-N |
| SMILES | CC=C(C)C(=O)OC1C2OCC3(C)C(OC(C)=O)CC(O)C(C)(C23)C2CC(O)OC3CC(c4ccoc4)C(C)=C3C12C |
| Hazard Codes | Xi |
|---|
| (2R,3aS,5R,6aR,6bR,6b<sup>1</sup>R,7S,9R,9aR,11aR,12S,12aR)-9-acetoxy-2-(furan-3-yl)-5,7-dihydroxy-1,6b,9a,12a-tetramethyl-3,3a,6,6a,6b,6b<sup>1</sup>,7,8,9,9a,10,11a,12,12a-tetradecahydro-2H,5H-cyclopenta[b]furo[2',3',4':4,5]naphtho[2,1-d]oxepin-12-yl (E)-2-methylbut-2-enoate |
| (2R,3aS,5R,6aR,6bR,7S,9R,9aR,11aR,11bR,12S,12aR)-9-Acetoxy-2-(3-furyl)-5,7-dihydroxy-1,6b,9a,12a-tetramethyl-3,3a,6,6a,6b,7,8,9,9a,10,11a,11b,12,12a-tetradecahydro-2H,5H-cyclopenta[b]furo[2',3',4':4,5]naphtho[2,1-d]oxepin-12-yl (2E)-2-methyl-2-butenoate |