diethyl 3-hydroxycyclobutane-1,1-dicarboxylate
Modify Date: 2025-09-18 21:44:43
diethyl 3-hydroxycyclobutane-1,1-dicarboxylate structure
|
Common Name | diethyl 3-hydroxycyclobutane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 99974-66-0 | Molecular Weight | 216.23100 | |
| Density | 1.238g/cm3 | Boiling Point | 272.939ºC at 760 mmHg | |
| Molecular Formula | C10H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.585ºC | |
| Name | Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 272.939ºC at 760 mmHg |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23100 |
| Flash Point | 97.585ºC |
| Exact Mass | 216.10000 |
| PSA | 72.83000 |
| LogP | 0.25370 |
| Index of Refraction | 1.497 |
| InChIKey | HCVGFHCQRXXAGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(O)C1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918199090 |
|
~89%
diethyl 3-hydro... CAS#:99974-66-0 |
| Literature: Satoh, Tsuyoshi; Kimura, Tsutomu; Sasaki, Yuki; Nagamoto, Shinobu Synthesis (Germany), 2012 , vol. 44, # 13 art. no. SS-2012-F0243-OP, p. 2091 - 2101 |
|
~%
diethyl 3-hydro... CAS#:99974-66-0 |
| Literature: Chemische Berichte, , vol. 90, p. 1424,1427 |
![3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid structure](https://image.chemsrc.com/caspic/468/1363380-83-9.png)
CAS#:1363380-83-9![tert-butyl N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]carbamate structure](https://image.chemsrc.com/caspic/066/1232365-42-2.png)
CAS#:1232365-42-2
CAS#:827032-76-8
CAS#:827032-79-1| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diethyl 3-hydroxycyclobutane-1,1-dicarboxylate |