2050-49-9
2050-49-9 structure
- Name: 2,4-Dibromo-1-naphthol
- Chemical Name: 2,4-dibromonaphthalen-1-ol
- CAS Number: 2050-49-9
- Molecular Formula: C10H6Br2O
- Molecular Weight: 301.96200
- Create Date: 2018-06-01 08:00:00
- Modify Date: 2024-01-02 17:06:59
| Name | 2,4-dibromonaphthalen-1-ol |
|---|---|
| Synonyms |
2,4-DIBROMO-1-NAPHTHOL
2,4-dibromo-1-naphthalenol 2,4-Dibrom-[1]naphthol ACMC-1CDOF PSGUDVJPEWTBRM-UHFFFAOYSA InChI=1/C10H6Br2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H 2,4-Dibromonaphthalen-1-ol 2.4-Dibrom-1-hydroxy-naphthalin 1-Naphthalenol,2,4-dibromo 2,4-dibromo-[1]naphthol 2,3-DISTERAOYL-SN-GLYCERO-1-PHOSPHO-L-SERINE (MONOSODIUM SALT |
| Density | 1.956g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760mmHg |
| Melting Point | 107ºC |
| Molecular Formula | C10H6Br2O |
| Molecular Weight | 301.96200 |
| Flash Point | 169.7ºC |
| Exact Mass | 299.87900 |
| PSA | 20.23000 |
| LogP | 4.07040 |
| Vapour Pressure | 1.37E-05mmHg at 25°C |
| Index of Refraction | 1.726 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2908199090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
![1(4H)-Naphthalenone,4-[[4-(dimethylamino)phenyl]imino]- structure](https://image.chemsrc.com/caspic/338/132-31-0.png)
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |