α-Cyclodextrin structure
|
Common Name | α-Cyclodextrin | ||
|---|---|---|---|---|
| CAS Number | 10016-20-3 | Molecular Weight | 972.844 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1410.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C36H60O30 | Melting Point | 278ºC | |
| MSDS | Chinese USA | Flash Point | 807.1±32.9 °C | |
Use of α-Cyclodextrinα-Cyclodextrin is a multifunctional, soluble dietary fiber marketed for use as a fiber ingredient. |
| Name | α-cyclodextrin |
|---|---|
| Synonym | More Synonyms |
| Description | α-Cyclodextrin is a multifunctional, soluble dietary fiber marketed for use as a fiber ingredient. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1410.8±60.0 °C at 760 mmHg |
| Melting Point | 278ºC |
| Molecular Formula | C36H60O30 |
| Molecular Weight | 972.844 |
| Flash Point | 807.1±32.9 °C |
| Exact Mass | 972.316956 |
| PSA | 474.90000 |
| LogP | -6.55 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | HFHDHCJBZVLPGP-RWMJIURBSA-N |
| SMILES | OCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC1C(O)C2O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O |
| Storage condition | Store at RT. |
| Water Solubility | H2O: 50 mg/mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 29400090 |
|---|
|
Photoreversible polymer-surfactant micelles using the molecular recognition of α-cyclodextrin.
Langmuir 29(10) , 3188-94, (2013) Photoreversible micelles were achieved by a combination of commercially available components sodium alginate (Alg), tetradecyltrimethylammonium bromide (TTAB), α-cyclodextrin (α-CD), and 4-(phenylazo)... |
|
|
An intelligent anticorrosion coating based on pH-responsive supramolecular nanocontainers.
Nanotechnology 23(50) , 505705, (2012) The hollow mesoporous silica nanoparticles (HMSNs), which have been used as the nanocontainers for the corrosion inhibitor, benzotriazole, were fabricated using the hard-template method. Alkaline-resp... |
|
|
Beads made of α-cyclodextrin and soybean oil: the drying method influences bead properties and drug release.
Drug Dev. Ind. Pharm. 39(9) , 1306-14, (2013) Freeze-dried beads made of α-cyclodextrin and soybean oil were reported previously as an efficient system for the oral delivery of lipophilic drugs. In the present study, oven-drying was evaluated as ... |
| Ringdex A |
| (5R,10R,15R,20R,25R,30R,31R,32R,33R,34R,35R,36R,37R,38R,39R,40R,41R,42R)-5,10,15,20,25,30-hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane-31,32,33,34,35,36,37,38,39,40,41,42-dodecol |
| (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31R,32R,33R,34R,35R,36R,37R,38R,39R,40R,41R,42R)-5,10,15,20,25,30-Hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.2.2.2.2.2]dotetracontane-31,32,33,34,35,36,37,38,39,40,41,42-dodecol |
| α-CD,Cyclohexaamylose,cyclomaltohexaose |
| MFCD00078207 |
| Cyclohexapentylose |
| (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31R,32R,33R,34R,35R,36R,37R,38R,39R,40R,41R,42R)-5,10,15,20,25,30-Hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxahe ;ptacyclo[26.2.2.2.2.2.2.2]dotetracontane-31,32,33,34,35,36,37,38,39,40,41,42-dodecol |
| α-Cyclodextrin |
| a-Schardinger Dextrin |
| CYCLOMALTOHEXOSE |
| cyclomaltodextrin |
| a-Cycloamylose |
| alpha-cyclodextrin |
| Alfadex |
| Schardinger α-Dextrin |
| CYCLOHEXAAMYLOSE |
| cyclomaltohexaose |
| alpha-Cycloamylose |
| (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31R,32R,33R,34R,35R,36R,37R,38R,39R,40R,41R,42R)-5,10,15,20,25,30-Hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.2.2.2.2.2]dotetracontan-31,32,33,34,35,36,37,38,39,40,41,42-dodecol |
| Celdex A 100 |
| (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31R,32R,33R,34R,35R,36R,37R,38R,39R,40R,41R,42R)-5,10,15,20,25,30-Hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.2.2.2.2.2]dotetracontane-31,32,33,34,35,36,37,38,39,40,41,42-dodecol (non-preferred name) |
| α-Schardinger dextrin |
| α-Cycloamylose |
| a-Dextrin |
| Dexy Pearl a-100 |
| α-Dextrin |
| a-Cyclodextrin. |
| EINECS 233-007-4 |
| a-Cyclodextrin |