isobutyl oleate structure
|
Common Name | isobutyl oleate | ||
|---|---|---|---|---|
| CAS Number | 10024-47-2 | Molecular Weight | 338.56800 | |
| Density | 0.87g/cm3 | Boiling Point | 411.2ºC at 760 mmHg | |
| Molecular Formula | C22H42O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.4ºC | |
| Name | 2-methylpropyl (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.87g/cm3 |
|---|---|
| Boiling Point | 411.2ºC at 760 mmHg |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.56800 |
| Flash Point | 87.4ºC |
| Exact Mass | 338.31800 |
| PSA | 26.30000 |
| LogP | 7.22310 |
| Vapour Pressure | 5.69E-07mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | GXJLQJFVFMCVHG-QXMHVHEDSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(C)C |
| HS Code | 2916150000 |
|---|
|
~%
isobutyl oleate CAS#:10024-47-2 |
| Literature: Bournot Biochemische Zeitschrift, 1913 , vol. 52, p. 196,202 |
|
~%
isobutyl oleate CAS#:10024-47-2 |
| Literature: Isbell, Terry A.; Green, Lindsay A.; DeKeyser, Stephanie S.; Manthey, Linda K.; Kenar, James A.; Cermak, Steven C. JAOCS, Journal of the American Oil Chemists' Society, 2006 , vol. 83, # 5 p. 429 - 434 |
|
~%
isobutyl oleate CAS#:10024-47-2 |
| Literature: Ling; Geankoplis Industrial and Engineering Chemistry, 1958 , vol. 50, p. 939,941 |
| HS Code | 2916150000 |
|---|---|
| Summary | 2916150000 oleic, linoleic or linolenic acids, their salts and esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Oelsaeure-isobutylester |
| oleic acid isobutyl ester |
| Priolube 1414 |
| Isobutyloleat |
| EINECS 233-022-6 |
| 9-Octadecenoic acid (9Z)-,2-methylpropyl ester |
| Isobutyl oleate |