1-[dimethoxy-(4-nitrophenyl)methyl]-4-nitrobenzene structure
|
Common Name | 1-[dimethoxy-(4-nitrophenyl)methyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 100970-28-3 | Molecular Weight | 318.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[dimethoxy-(4-nitrophenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O6 |
|---|---|
| Molecular Weight | 318.28100 |
| Exact Mass | 318.08500 |
| PSA | 110.10000 |
| LogP | 4.04330 |
| InChIKey | LGGYPZHGWJXCIW-UHFFFAOYSA-N |
| SMILES | COC(OC)(c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~93%
1-[dimethoxy-(4... CAS#:100970-28-3 |
| Literature: Thurkauf, Andrew; Jacobson, Arthur E.; Rice, Kenner C. Synthesis, 1988 , # 3 p. 233 - 234 |
|
~%
1-[dimethoxy-(4... CAS#:100970-28-3 |
| Literature: Sisu, Eugen; Sisu, Ioana; Dinca, Nicolae; Csunderlik, Carol; Oprean, Ioan; Rusu, Vasile; Mracec, Mircea Revue Roumaine de Chimie, 2002 , vol. 47, # 3-4 p. 339 - 342 |
|
~%
1-[dimethoxy-(4... CAS#:100970-28-3 |
| Literature: Gorvin Journal of the Chemical Society, 1959 , p. 678,680 |
| Benzene,1,1'-(dimethoxymethylene)bis[4-nitro |
| bis(4-nitrophenyl)dimethoxymethane |
| 4,4'-dinitro-benzophenone-dimethylacetal |
| 4,4'-Dinitro-benzophenon-dimethylacetal |