1-[dibromo-(4-nitrophenyl)methyl]-4-nitro-benzene structure
|
Common Name | 1-[dibromo-(4-nitrophenyl)methyl]-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5397-81-9 | Molecular Weight | 416.02200 | |
| Density | 1.893g/cm3 | Boiling Point | 496.3ºC at 760 mmHg | |
| Molecular Formula | C13H8Br2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 1-[dibromo-(4-nitrophenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.893g/cm3 |
|---|---|
| Boiling Point | 496.3ºC at 760 mmHg |
| Molecular Formula | C13H8Br2N2O4 |
| Molecular Weight | 416.02200 |
| Flash Point | 254ºC |
| Exact Mass | 413.88500 |
| PSA | 91.64000 |
| LogP | 5.54030 |
| Index of Refraction | 1.686 |
| InChIKey | AMFZEKAEZCXBNB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(Br)(Br)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-[dibromo-(4-n... CAS#:5397-81-9 |
| Literature: Gorvin Journal of the Chemical Society, 1955 , p. 83,86 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Bis-<4-nitro-phenyl>-dibrommethan |
| 1,1'-(dibromomethanediyl)bis(4-nitrobenzene) |
| Dibrom-bis-(4-nitro-phenyl)-methan |
| dibromo-bis-(4-nitro-phenyl)-methane |