resorufin beta-d-glucopyranoside structure
|
Common Name | resorufin beta-d-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 101490-85-1 | Molecular Weight | 375.32900 | |
| Density | 1.71g/cm3 | Boiling Point | 651.6ºC at 760 mmHg | |
| Molecular Formula | C18H17NO8 | Melting Point | 218-220℃ (decomposition) | |
| MSDS | USA | Flash Point | 347.9ºC | |
| Name | 7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 651.6ºC at 760 mmHg |
| Melting Point | 218-220℃ (decomposition) |
| Molecular Formula | C18H17NO8 |
| Molecular Weight | 375.32900 |
| Flash Point | 347.9ºC |
| Exact Mass | 375.09500 |
| PSA | 142.48000 |
| Vapour Pressure | 7.25E-18mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | QULZFZMEBOATFS-UYTYNIKBSA-N |
| SMILES | O=c1ccc2nc3ccc(OC4OC(CO)C(O)C(O)C4O)cc3oc-2c1 |
| Storage condition | −20°C |
| Water Solubility | DMF: soluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29400090 |
|
~91%
resorufin beta-... CAS#:101490-85-1 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 38, # 12 p. 3466 - 3470 |
|
~%
resorufin beta-... CAS#:101490-85-1 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 38, # 12 p. 3466 - 3470 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Resorufin A-D-Glucopyranoside |