1H,1H,2H,2H-PERFLUORODECYLTRIETHOXYSILANE structure
|
Common Name | 1H,1H,2H,2H-PERFLUORODECYLTRIETHOXYSILANE | ||
|---|---|---|---|---|
| CAS Number | 101947-16-4 | Molecular Weight | 610.379 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 301.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H19F17O3Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 136.2±27.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.5±42.0 °C at 760 mmHg |
| Molecular Formula | C16H19F17O3Si |
| Molecular Weight | 610.379 |
| Flash Point | 136.2±27.9 °C |
| Exact Mass | 610.083191 |
| PSA | 27.69000 |
| LogP | 8.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.341 |
| InChIKey | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 1760 8/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 8.0 |
|
Superphobicity/philicity Janus fabrics with switchable, spontaneous, directional transport ability to water and oil fluids.
Sci. Rep. 3 , 2964, (2013) Herein we demonstrate that switchable, spontaneous, directional-transport ability to both water and oil fluids can be created on fabric materials through wet-chemistry coating and successive UV irradi... |
|
|
Desalination of sodium chloride solutions and seawater with hydrophobic ceramic membranes Gazagnes L, et al.
Desalination 217 , 260-266, (2007)
|
|
|
Preparation and characterization of slice-like Cu2(OH)3NO3 superhydrophobic structure on copper foil Kong L, et al.
Appl. Surf. Sci. 264(22) , 7255-7258, (2008)
|
| Triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| Triethoxy-1H,1H,2H,2H-heptadecafluorodecylsilane |
| Triethoxy-1H,1H,2H,2H-perfluorodecylsilane |
| MFCD00042334 |
| Silane, triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)- |