1H,1H,2H,2H-Perfluorododecyltrichlorosilane structure
|
Common Name | 1H,1H,2H,2H-Perfluorododecyltrichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 102488-49-3 | Molecular Weight | 681.57100 | |
| Density | 1.656g/cm3 | Boiling Point | 264.7ºC at 760mmHg | |
| Molecular Formula | C12H4Cl3F21Si | Melting Point | 50-55°C(lit.) | |
| MSDS | USA | Flash Point | 113.9ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.656g/cm3 |
|---|---|
| Boiling Point | 264.7ºC at 760mmHg |
| Melting Point | 50-55°C(lit.) |
| Molecular Formula | C12H4Cl3F21Si |
| Molecular Weight | 681.57100 |
| Flash Point | 113.9ºC |
| Exact Mass | 679.88100 |
| LogP | 9.31180 |
| InChIKey | ZFUVZJADECZZMS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C: Corrosive; |
| RIDADR | UN 2987 8 / PGII |
|
~99%
1H,1H,2H,2H-Per... CAS#:102488-49-3 |
| Literature: Yoshino, Norio; Yamamoto, Yasushi; Hamano, Katsumi; Kawase, Tokuzo Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 6 p. 1754 - 1758 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Photopatternable self-assembled monolayers as micron scale templates for polymer based field effect transistors
Appl. Phys. Lett. 94(1) , 013502, (2009)
|
|
|
Superhydrophobic modification of TiO 2 nanocomposite PVDF membranes for applications in membrane distillation.
J. Memb. Sci. 415 , 850-863, (2012)
|
|
|
A paper microfluidic cartridge for automated staining of malaria parasites with an optically transparent microscopy window.
Lab Chip 14(12) , 2040-2046, (2014)
|
| PC8947 |
| trichloro-1H,1H,2H,2H-perfluorododecylsilane |
| 1H,1H,2H,2H-Perfluorododecyltrichlorosilane |
| Henicosafluorododecyltrichlorosilane |