Methyl 7-methoxy-2,2-diphenyl-1,3-benzodioxole-5-carboxylate structure
|
Common Name | Methyl 7-methoxy-2,2-diphenyl-1,3-benzodioxole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 102706-14-9 | Molecular Weight | 362.37500 | |
| Density | 1.252g/cm3 | Boiling Point | 496ºC at 760mmHg | |
| Molecular Formula | C22H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | Methyl 7-methoxy-2,2-diphenyl-1,3-benzodioxole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 496ºC at 760mmHg |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.37500 |
| Flash Point | 217.3ºC |
| Exact Mass | 362.11500 |
| PSA | 53.99000 |
| LogP | 4.15430 |
| Vapour Pressure | 5.6E-10mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | WVRUKYMJAFHADO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-methoxy-2,2-diphenyl-benzo[1,3]dioxole-5-carboxylic acid methyl ester |
| 7-Methoxy-2,2-diphenyl-benzo[1,3]dioxol-5-carbonsaeure-methylester |
| methyl 3-methoxy-4,5-diphenylmethylenedioxybenzoate |
| 1,3-Benzodioxole-5-carboxylicacid,7-methoxy-2,2-diphenyl-,methyl ester |