2'-Deoxycytidine-5'-monophosphoric acid structure
|
Common Name | 2'-Deoxycytidine-5'-monophosphoric acid | ||
|---|---|---|---|---|
| CAS Number | 1032-65-1 | Molecular Weight | 307.197 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 633.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C9H14N3O7P | Melting Point | 169-172 °C (dec.) | |
| MSDS | USA | Flash Point | 337.1±34.3 °C | |
| Name | dCMP |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.8±65.0 °C at 760 mmHg |
| Melting Point | 169-172 °C (dec.) |
| Molecular Formula | C9H14N3O7P |
| Molecular Weight | 307.197 |
| Flash Point | 337.1±34.3 °C |
| Exact Mass | 307.056946 |
| PSA | 166.94000 |
| LogP | -2.17 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.743 |
| InChIKey | NCMVOABPESMRCP-SHYZEUOFSA-N |
| SMILES | Nc1ccn(C2CC(O)C(COP(=O)(O)O)O2)c(=O)n1 |
| Storage condition | 2-8°C |
| Water Solubility | H2O: 10 mg/mL, clear, colorless |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn,Xi |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Development of an electrochemical surface-enhanced Raman spectroscopy (EC-SERS) aptasensor for direct detection of DNA hybridization.
Phys. Chem. Chem. Phys. 17 , 21356-63, (2015) Rapid detection of disease biomarkers at the patient point-of-care is essential to timely and effective treatment. The research described herein focuses on the development of an electrochemical surfac... |
|
|
Metal free columns for determination of deoxynucleotide monophosphate by liquid chromatography/mass spectrometry and application to oligonucleotide.
J. Chromatogr. A. 1406 , 210-4, (2015) We have developed a highly sensitive method for the analysis of deoxynucleotide monophosphates (dNMPs), which involves the use of liquid chromatography/mass spectrometry (LC/MS) and a new metal-free c... |
|
|
The mechanism of action of beta-D-2'-deoxy-2'-fluoro-2'-C-methylcytidine involves a second metabolic pathway leading to beta-D-2'-deoxy-2'-fluoro-2'-C-methyluridine 5'-triphosphate, a potent inhibitor of the hepatitis C virus RNA-dependent RNA polymerase.
Antimicrob. Agents Chemother. 52 , 458-64, (2008) beta-D-2'-Deoxy-2'-fluoro-2'-C-methylcytidine (PSI-6130) is a potent inhibitor of hepatitis C virus (HCV) RNA replication in an HCV replicon assay. The 5'-triphosphate of PSI-6130 is a competitive inh... |
| 2'-Deoxycytidine 5'-monophosphate |
| 2(1H)-pyrimidinone, 4-amino-1-(2-deoxy-5-O-phosphono-β-D-glycero-pentofuranosyl)- |
| [(2R,3S,5R)-5-(4-Amino-2-oxo-1(2H)-pyrimidinyl)-3-hydroxytetrahydro-2-furanyl]methyl dihydrogen phosphate |
| Deoxycytidylic acid |
| 2′-Deoxycytidine 5′-monophosphate |
| 2-pyrimidinol, 1-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-1,4-dihydro-4-imino- |
| Deoxycytidine-5'-monophosphoric acid |
| Deoxycytidylic Acid Hydrate |
| 5'-Cytidylic acid, 2'-deoxy- |
| dCMP |
| 2'-Deoxycytidylic acid |
| 2'-Deoxycytidine-5'-monophosphoric acid |
| 2-Deoxycytidine-5'-monophosphoric acid |
| Deoxycytidine monophosphate |
| 2'-Deoxy-5'-cytidylic acid |
| deoxycytidine 5'-phosphate |
| 2'-Deoxycytidine 5'-Monophosphate Hydrate |
| MFCD00006546 |
| EINECS 213-849-9 |
| 4-Amino-1-(2-deoxy-5-O-phosphono-β-D-glycero-pentofuranosyl)pyrimidin-2(1H)-one |