Diethyl 4,4'-[1,2-ethanediylbis(oxy)]dibenzoate structure
|
Common Name | Diethyl 4,4'-[1,2-ethanediylbis(oxy)]dibenzoate | ||
|---|---|---|---|---|
| CAS Number | 25909-66-4 | Molecular Weight | 358.385 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 496.0±30.0 °C at 760 mmHg | |
| Molecular Formula | C20H22O6 | Melting Point | 108ºC | |
| MSDS | N/A | Flash Point | 216.6±24.6 °C | |
| Name | ethyl 4-[2-(4-ethoxycarbonylphenoxy)ethoxy]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.0±30.0 °C at 760 mmHg |
| Melting Point | 108ºC |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.385 |
| Flash Point | 216.6±24.6 °C |
| Exact Mass | 358.141632 |
| PSA | 71.06000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | XTHNYIOBLBKRMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCCOc2ccc(C(=O)OCC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
Diethyl 4,4'-[1... CAS#:25909-66-4 |
| Literature: US3981906 A1, ; |
|
~%
Diethyl 4,4'-[1... CAS#:25909-66-4 |
| Literature: Doklady Akademii Nauk Armyanskoi SSR, , vol. 18, p. 111,115 Chem.Abstr., , p. 10932 Journal of Organic Chemistry, , vol. 26, p. 474 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Bis(4-ethoxycarbonylphenoxy)ethane |
| 4,4'-Aethandiyldioxy-di-benzoesaeure-diaethylester |
| Diethyl 4,4'-[ethane-1,2-diylbis(oxy)]dibenzoate |
| Benzoic acid, 4,4'-[1,2-ethanediylbis(oxy)]bis-, diethyl ester |
| 4,4'-ethanediyldioxy-di-benzoic acid diethyl ester |
| 1,2-Bis(4-carbethoxyphenoxy)ethane |
| Diethyl 4,4'-[1,2-ethanediylbis(oxy)]dibenzoate |
| E0414 |
| Ethylene Glycol Bis(4-carbethoxyphenyl) Ether |