5,7-Dimethoxyflavanone structure
|
Common Name | 5,7-Dimethoxyflavanone | ||
|---|---|---|---|---|
| CAS Number | 1036-72-2 | Molecular Weight | 284.30700 | |
| Density | 1.204g/cm3 | Boiling Point | 468.8ºC at 760mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | 144-146ºC | |
| MSDS | N/A | Flash Point | 209.4ºC | |
Use of 5,7-Dimethoxyflavanone5,7-Dimethoxyflavanone is an active compound. 5,7-Dimethoxyflavanone can be Isolated from the roots of Zanthoxylum nitidum[1]. |
| Name | 5,7-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 5,7-Dimethoxyflavanone is an active compound. 5,7-Dimethoxyflavanone can be Isolated from the roots of Zanthoxylum nitidum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760mmHg |
| Melting Point | 144-146ºC |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 209.4ºC |
| Exact Mass | 284.10500 |
| PSA | 44.76000 |
| LogP | 3.41030 |
| Vapour Pressure | 5.79E-09mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | IAFBOKYTDSDNHV-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)OC(c1ccccc1)CC2=O |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-dimethylpinocembrin |
| Dimethylpinocembrin |
| 5,7-dimethoxy-2-phenylchroman-4-one |
| 5,7-Dimethoxyflavanon |
| 5,7-Dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| 5,7-dimethoxyflavone |
| 5,7-methoxyflavanone |
| 5,7-Dimethoxyflavonone |
| 2-phenyl-5,7-dimethoxyl-flavanone |