5,7-DIMETHOXYISOFLAVONE
5,7-DIMETHOXYISOFLAVONE structure
|
Common Name | 5,7-DIMETHOXYISOFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 26964-35-2 | Molecular Weight | 282.29100 | |
| Density | 1.242g/cm3 | Boiling Point | 476.6ºC at 760mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
Summary: 5,7-dimethoxy-3-phenylchromen-4-one (CAS: 26964-35-2) is a bioactive compound with molecular formula C17H14O4 and molecular weight 282.29100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-dimethoxy-3-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 476.6ºC at 760mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 213.5ºC |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| Vapour Pressure | 3.01E-09mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | CDSSYLTXYXEANW-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccccc3)coc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914509090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:1036-72-2
CAS#:153488-99-4
CAS#:90-24-4
CAS#:1775-97-9
CAS#:54107-66-3
CAS#:3076-54-8
CAS#:153488-88-1
CAS#:101521-59-9
CAS#:39604-66-5
CAS#:109-94-4
CAS#:4044-00-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,7-Dimethoxyisoflavon |
| 5,7-dimethoxyisoflavone |
| 5,7-dimethoxy-3-phenyl-chromen-4-one |
| 5,7-dimethoxy-3-phenyl-4H-chromen-4-one |
| 5,7-Dimethoxy-3-phenyl-chromen-4-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: Related upstream materials(CAS) of 5,7-dimethoxy-3-phenylchromen-4-one: 1036-72-2;153488-99-4;90-24-4;1775-97-9;54107-66-3;3076-54-8;153488-88-1;101521-59-9;39604-66-5;109-94-4. |
| Q: What is the polar surface area (PSA) of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: Polar surface area (PSA) of 5,7-dimethoxy-3-phenylchromen-4-one is 48.67000. |
| Q: What is the boiling point of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: Boiling point of 5,7-dimethoxy-3-phenylchromen-4-one is 476.6ºC at 760mmHg. |
| Q: What is the molecular formula of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: Molecular formula of 5,7-dimethoxy-3-phenylchromen-4-one is C17H14O4. |
| Q: What is the LogP of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: LogP of 5,7-dimethoxy-3-phenylchromen-4-one is 3.47720. |
| Q: What is the English name of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: The English name of 5,7-dimethoxy-3-phenylchromen-4-one is 5,7-dimethoxy-3-phenylchromen-4-one. |
| Q: What is the CAS number of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: CAS number of 5,7-dimethoxy-3-phenylchromen-4-one is 26964-35-2. |
| Q: What is the SMILES notation of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: SMILES notation of 5,7-dimethoxy-3-phenylchromen-4-one is COc1cc(OC)c2c(=O)c(-c3ccccc3)coc2c1. |
| Q: What is the molecular weight of 5,7-dimethoxy-3-phenylchromen-4-one? |
| A: Molecular weight of 5,7-dimethoxy-3-phenylchromen-4-one is 282.29100. |
| Q: What English synonyms does 5,7-dimethoxy-3-phenylchromen-4-one have? |
| A: English synonyms of 5,7-dimethoxy-3-phenylchromen-4-one: 5,7-Dimethoxyisoflavon, 5,7-dimethoxyisoflavone, 5,7-dimethoxy-3-phenyl-chromen-4-one, 5,7-dimethoxy-3-phenyl-4H-chromen-4-one, 5,7-Dimethoxy-3-phenyl-chromen-4-on. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |