Flavokawain B structure
|
Common Name | Flavokawain B | ||
|---|---|---|---|---|
| CAS Number | 1775-97-9 | Molecular Weight | 284.306 | |
| Density | 1.203±0.06 g/cm3 | Boiling Point | 500.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | 178-179 ºC (ethanol ) | |
| MSDS | N/A | Flash Point | 185.8±23.6 °C | |
Use of Flavokawain BFlavokawain B (Flavokavain B) is a chalcone isolated from the root extracts of kava-kava plant and a potent apoptosis inducer for inhibiting the growth of various cancer cell lines. Flavokawain B (Flavokavain B) shows strong antiangiogenic activity. Flavokawain B (Flavokavain B) inhibits human brain endothelial cell (HUVEC) migration and tube formation with very low and non-toxic concentrations[1][2]. |
| Name | 4',6'-dimethoxy-2'-hydroxychalcone |
|---|---|
| Synonym | More Synonyms |
| Description | Flavokawain B (Flavokavain B) is a chalcone isolated from the root extracts of kava-kava plant and a potent apoptosis inducer for inhibiting the growth of various cancer cell lines. Flavokawain B (Flavokavain B) shows strong antiangiogenic activity. Flavokawain B (Flavokavain B) inhibits human brain endothelial cell (HUVEC) migration and tube formation with very low and non-toxic concentrations[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.203±0.06 g/cm3 |
|---|---|
| Boiling Point | 500.1±50.0 °C at 760 mmHg |
| Melting Point | 178-179 ºC (ethanol ) |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.306 |
| Flash Point | 185.8±23.6 °C |
| Exact Mass | 284.104858 |
| PSA | 55.76000 |
| LogP | 4.01 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | QKQLSQLKXBHUSO-CMDGGOBGSA-N |
| SMILES | COc1cc(O)c(C(=O)C=Cc2ccccc2)c(OC)c1 |
| Storage condition | -20℃ |
| Water Solubility | Practically insoluble (0.012 g/L) (25 ºC) |
| HS Code | 2914509090 |
|---|
|
~92%
Flavokawain B CAS#:1775-97-9 |
| Literature: Singh, Om V.; Muthukrishnan; Sunderavadivelu Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 12 p. 2575 - 2581 |
|
~%
Flavokawain B CAS#:1775-97-9 |
| Literature: Pouget, Christelle; Lauthier, Fabienne; Simon, Alain; Fagnere, Catherine; Basly, Jean-Philippe; Delage, Christiane; Chulia, Albert-Jose Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 24 p. 3095 - 3097 |
|
~%
Flavokawain B CAS#:1775-97-9 |
| Literature: Seo, Young Ho; Park, Sun You Bulletin of the Korean Chemical Society, 2014 , vol. 35, # 4 p. 1154 - 1158 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| CARDAMONIN-4'-METHYL ETHER |
| 2'-Hydroxy-4',6'-dimethoxychalcone |
| flavokawin B |
| (2E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenyl-2-propen-1-one |
| (2E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| 1OR CQ EO1 BV1U1R &&E Form |
| MFCD00075877 |
| DIMETHOXY-2'-HYDROXYCHALCONE,4',6' |
| Flavokawain B |
| Flavokavain B |