Dimethyl stilbene-4,4'-dicarboxylate structure
|
Common Name | Dimethyl stilbene-4,4'-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 10374-80-8 | Molecular Weight | 296.31700 | |
| Density | 1.192g/cm3 | Boiling Point | 448.3ºC at 760 mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.3ºC | |
| Name | Dimethyl stilbene-4,4'-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 448.3ºC at 760 mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 226.3ºC |
| Exact Mass | 296.10500 |
| PSA | 52.60000 |
| LogP | 3.43020 |
| Index of Refraction | 1.619 |
| InChIKey | JOODVYOWCWQPMV-ONEGZZNKSA-N |
| SMILES | COC(=O)c1ccc(C=Cc2ccc(C(=O)OC)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
Dimethyl stilbe... CAS#:10374-80-8 |
| Literature: Russell,G.A. et al. Journal of the American Chemical Society, 1962 , vol. 84, p. 2652 - 2653 |
|
~%
Dimethyl stilbe... CAS#:10374-80-8 |
| Literature: Russell,G.A.; Becker,H.D. Journal of the American Chemical Society, 1963 , vol. 85, p. 3406 - 3410 |
|
~%
Dimethyl stilbe... CAS#:10374-80-8 |
| Literature: Meyer,H.; Hofmann Monatshefte fuer Chemie, 1917 , vol. 38, p. 357 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4'-Stilben-dicarbonsaeure-dimethylester |
| Stilben-4,4'-dicarbonsaeure-dimethylester |
| 2,3-Diphenyl-but-2-en |
| dimethylstilbene-4,4'-dicarboxylate |
| stilbene-4,4'-dicarboxylic acid dimethyl ester |
| dimethyl 4,4'-stilbenedicarboxylate |
| 2,3-diphenyl-but-2-ene |
| dimethylstilbene |
| 2,3-Diphenyl-2-butene |