Esclentic acid structure
|
Common Name | Esclentic acid | ||
|---|---|---|---|---|
| CAS Number | 103974-74-9 | Molecular Weight | 488.70 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 609.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.4±28.0 °C | |
Use of Esclentic acidEsculentic acid is a selective COX-2 inhibitor and has anti-inflammatory effect. Esculentic acid is a pentacyclic triterpenoid that can be extracted from the Chinese herb Phytolacca esculenta[1][2]. |
| Name | (2α,3α)-2,3,23-Trihydroxyurs-12-en-28-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Esculentic acid is a selective COX-2 inhibitor and has anti-inflammatory effect. Esculentic acid is a pentacyclic triterpenoid that can be extracted from the Chinese herb Phytolacca esculenta[1][2]. |
|---|---|
| Related Catalog | |
| Target |
COX-2[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.4±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.70 |
| Flash Point | 336.4±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.46 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | JXSVIVRDWWRQRT-SVOQGVCWSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1C |
| Hazard Codes | Xi |
|---|
| Urs-12-en-28-oic acid, 2,3,23-trihydroxy-, (2α,3α)- |
| (2α,3α)-2,3,23-Trihydroxyurs-12-en-28-oic acid |
| Esclentic acid |
| dodeca-2c,7t,10t-triene-1,4-diol |