CP-67804 structure
|
Common Name | CP-67804 | ||
|---|---|---|---|---|
| CAS Number | 103978-08-1 | Molecular Weight | 345.29700 | |
| Density | 1.456g/cm3 | Boiling Point | 526.5ºC at 760 mmHg | |
| Molecular Formula | C18H13F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.2ºC | |
Use of CP-67804CP-67804 is a quinolone derivative, is a topoisomerase II-targeted agent. CP-67804 effectively enhances DNA cleavage mediated by eukaryotic topoisomerase II. CP-67804 has potential as an antineoplastic agent[1]. |
| Name | 1-ethyl-6,8-difluoro-7-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | CP-67804 is a quinolone derivative, is a topoisomerase II-targeted agent. CP-67804 effectively enhances DNA cleavage mediated by eukaryotic topoisomerase II. CP-67804 has potential as an antineoplastic agent[1]. |
|---|---|
| Related Catalog | |
| Target |
Topoisomerase II |
| In Vitro | CP-67804 increases topoisomerase II-mediated DNA breakages by enhancing the enzyme's forward rate of cleavage[1]. |
| References |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 526.5ºC at 760 mmHg |
| Molecular Formula | C18H13F2NO4 |
| Molecular Weight | 345.29700 |
| Flash Point | 272.2ºC |
| Exact Mass | 345.08100 |
| PSA | 79.53000 |
| LogP | 3.37040 |
| Vapour Pressure | 6.52E-12mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | MYERGISJXHBTKE-UHFFFAOYSA-N |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(-c3ccc(O)cc3)c(F)c21 |
| 3-Quinolinecarboxylic acid,1-ethyl-6,8-difluoro-1,4-dihydro-7-(4-hydroxyphenyl)-4-oxo |
| 1-Ethyl-6,8-difluoro-7-(4-hydroxyphenyl)-4-quinolone-3-carboxylic acid |
| CP-67,804 |