Benzeneethanol,4-nitro-, 1-acetate structure
|
Common Name | Benzeneethanol,4-nitro-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 104-30-3 | Molecular Weight | 209.19900 | |
| Density | 1.226g/cm3 | Boiling Point | 330.8ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
| Name | 2-(4-nitrophenyl)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 330.8ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 149.9ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.22360 |
| Vapour Pressure | 0.000162mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | PZCUSZBIRGTJPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2915390090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| acetic acid-(4-nitro-phenethyl ester) |
| EINECS 203-193-1 |
| 4-Nitro-12-acetoxy-1-aethyl-benzol |
| P-NITROPHENETHYL ALCOHOL,ACETATE |
| Benzeneethanol,4-nitro-,1-acetate |
| 4-nitrophenethyl acetate |
| 2-Acetoxy-1-(4-nitro-phenyl)-aethan |
| Essigsaeure-(4-nitro-phenaethylester) |
| (4-Nitro-phenaethyl)-acetat |
| p-Nitrophenethyl acetate |
| Benzeneethanol,acetate (ester) |