Benzeneethanol,4-nitro-, 1-acetate
Benzeneethanol,4-nitro-, 1-acetate structure
|
Common Name | Benzeneethanol,4-nitro-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 104-30-3 | Molecular Weight | 209.19900 | |
| Density | 1.226g/cm3 | Boiling Point | 330.8ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-nitrophenyl)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 330.8ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 149.9ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.22360 |
| Vapour Pressure | 0.000162mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | PZCUSZBIRGTJPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCc1ccc([N+](=O)[O-])cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2915390090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:130546-37-1
CAS#:33709-38-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| acetic acid-(4-nitro-phenethyl ester) |
| EINECS 203-193-1 |
| 4-Nitro-12-acetoxy-1-aethyl-benzol |
| P-NITROPHENETHYL ALCOHOL,ACETATE |
| Benzeneethanol,4-nitro-,1-acetate |
| 4-nitrophenethyl acetate |
| 2-Acetoxy-1-(4-nitro-phenyl)-aethan |
| Essigsaeure-(4-nitro-phenaethylester) |
| (4-Nitro-phenaethyl)-acetat |
| p-Nitrophenethyl acetate |
| Benzeneethanol,acetate (ester) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(4-nitrophenyl)ethyl acetate? |
| A: The English name of 2-(4-nitrophenyl)ethyl acetate is 2-(4-nitrophenyl)ethyl acetate. |
| Q: What is the Chinese name of 104-30-3? |
| A: Chinese name of 104-30-3 is 104-30-3. |
| Q: What is the CAS number of 2-(4-nitrophenyl)ethyl acetate? |
| A: CAS number of 2-(4-nitrophenyl)ethyl acetate is 104-30-3. |
| Q: What English synonyms does 2-(4-nitrophenyl)ethyl acetate have? |
| A: English synonyms of 2-(4-nitrophenyl)ethyl acetate: acetic acid-(4-nitro-phenethyl ester), EINECS 203-193-1, 4-Nitro-12-acetoxy-1-aethyl-benzol, P-NITROPHENETHYL ALCOHOL,ACETATE, Benzeneethanol,4-nitro-,1-acetate, 4-nitrophenethyl acetate, 2-Acetoxy-1-(4-nitro-phenyl)-aethan, Essigsaeure-(4-nitro-phenaethylester), (4-Nitro-phenaethyl)-acetat, p-Nitrophenethyl acetate, Benzeneethanol,acetate (ester). |
| Q: What is the polar surface area (PSA) of 2-(4-nitrophenyl)ethyl acetate? |
| A: Polar surface area (PSA) of 2-(4-nitrophenyl)ethyl acetate is 72.12000. |
| Q: What is the boiling point of 2-(4-nitrophenyl)ethyl acetate? |
| A: Boiling point of 2-(4-nitrophenyl)ethyl acetate is 330.8ºC at 760mmHg. |
| Q: What is the SMILES notation of 2-(4-nitrophenyl)ethyl acetate? |
| A: SMILES notation of 2-(4-nitrophenyl)ethyl acetate is CC(=O)OCCc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of 2-(4-nitrophenyl)ethyl acetate? |
| A: Molecular formula of 2-(4-nitrophenyl)ethyl acetate is C10H11NO4. |
| Q: What is the LogP of 2-(4-nitrophenyl)ethyl acetate? |
| A: LogP of 2-(4-nitrophenyl)ethyl acetate is 2.22360. |
| Q: What is the molecular weight of 2-(4-nitrophenyl)ethyl acetate? |
| A: Molecular weight of 2-(4-nitrophenyl)ethyl acetate is 209.19900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |