(n-chloroacetyl)-(4s)-benzyl-2-oxazolidinone structure
|
Common Name | (n-chloroacetyl)-(4s)-benzyl-2-oxazolidinone | ||
|---|---|---|---|---|
| CAS Number | 104324-16-5 | Molecular Weight | 253.68200 | |
| Density | 1.347g/cm3 | Boiling Point | 416.2ºC at 760mmHg | |
| Molecular Formula | C12H12ClNO3 | Melting Point | 78-82ºC(lit.) | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | (4S)-4-benzyl-3-(2-chloroacetyl)-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 416.2ºC at 760mmHg |
| Melting Point | 78-82ºC(lit.) |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68200 |
| Flash Point | 205.5ºC |
| Exact Mass | 253.05100 |
| PSA | 46.61000 |
| LogP | 1.75320 |
| Vapour Pressure | 3.88E-07mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | DVPUBLCBQBQPOU-JTQLQIEISA-N |
| SMILES | O=C(CCl)N1C(=O)OCC1Cc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~%
(n-chloroacetyl... CAS#:104324-16-5 |
| Literature: Journal of the American Chemical Society, , vol. 108, # 21 p. 6757 - 6761 |
|
~%
(n-chloroacetyl... CAS#:104324-16-5 |
| Literature: Journal of the American Chemical Society, , vol. 108, # 21 p. 6757 - 6761 |
|
~98%
(n-chloroacetyl... CAS#:104324-16-5 |
| Literature: Son, Jung Beom; Kim, Si Nae; Kim, Na Yeong; Hwang, Min-Ho; Lee, Wonsun; Lee, Duck Hyung Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 3 p. 653 - 663 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00269662 |
| (4S)-(+)-3-(chloroacetyl)-4-(phenylmethyl)-2-oxazolidinone |
| (N-Chloroacetyl)-(4S)-benzyl-2-oxazolidinone |
| (S)-4-Benzyl-3-chloroacetyl-2-oxazolidinone |
| (S)-4-benzyl-3-(2-chloroacetyl)-oxazolidin-2-one |