Typhaneoside structure
|
Common Name | Typhaneoside | ||
|---|---|---|---|---|
| CAS Number | 104472-68-6 | Molecular Weight | 770.685 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 1065.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C34H42O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.6±27.8 °C | |
Use of TyphaneosideTyphaneoside, extracted from Typha angustifolia L., Typhaneoside can inhibit the excessive autophagy of hypoxia/reoxygenation cells and increase the phosphorylation of Akt and mTOR. Typhaneoside has certain effects on the cardiovascular system, including lowering blood lipid levels, promoting antiatherosclerosis activities, as well as improving immune and coagulation function[1]. |
| Name | 3-[(3R,4S,5S,6R)-4,5-dihydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Typhaneoside, extracted from Typha angustifolia L., Typhaneoside can inhibit the excessive autophagy of hypoxia/reoxygenation cells and increase the phosphorylation of Akt and mTOR. Typhaneoside has certain effects on the cardiovascular system, including lowering blood lipid levels, promoting antiatherosclerosis activities, as well as improving immune and coagulation function[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 1065.0±65.0 °C at 760 mmHg |
| Molecular Formula | C34H42O20 |
| Molecular Weight | 770.685 |
| Flash Point | 332.6±27.8 °C |
| Exact Mass | 770.226929 |
| PSA | 317.35000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | POMAQDQEVHXLGT-QQVXUORWSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC2OC(COC3OC(C)C(O)C(O)C3O)C(O)C(O)C2OC2OC(C)C(O)C(O)C2O)ccc1O |
| Storage condition | 2~8°C |
| Hazard Codes | Xi |
|---|
| I07-0144 |
| 4H-1-Benzopyran-4-one, 3-[[O-6-deoxy-α-L-mannopyranosyl-(1->2)-O-[6-deoxy-α-L-mannopyranosyl-(1->6)]-β-D-glucopyranosyl]oxy]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)- |
| Typhaneoside |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl 6-deoxy-α-L-mannopyranosyl-(1->2)-[6-deoxy-α-L-mannopyranosyl-(1->6)]-β-D-glucopyranoside |
| N1474 |
| isorhamnetin 3-O-2G-rhamnosylrutinoside |