Ganoderol B structure
|
Common Name | Ganoderol B | ||
|---|---|---|---|---|
| CAS Number | 104700-96-1 | Molecular Weight | 440.701 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 552.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1±24.7 °C | |
Use of Ganoderol BGanoderol B is a potent α-glucosidase inhibitor. Ganoderol B has high α-glucosidase inhibition with an IC50 of 48.5 μg/mL (119.8 μM)[1]. |
| Name | (3S,10S,13R,14R,17S)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderol B is a potent α-glucosidase inhibitor. Ganoderol B has high α-glucosidase inhibition with an IC50 of 48.5 μg/mL (119.8 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 552.7±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.701 |
| Flash Point | 226.1±24.7 °C |
| Exact Mass | 440.365417 |
| PSA | 40.46000 |
| LogP | 8.82 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | AOXXVRDKZLRGTJ-SAXMSOSVSA-N |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=CCC4C(C)(CCC(O)C4(C)C)C3=CCC12C)CO |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| ganoderol B |
| Lanosta-7,9(11),24-triene-3,26-diol, (3β,24E)- |
| (3β,24E)-Lanosta-7,9(11),24-triene-3,26-diol |
| Ganodermadiol |