clodinafop-propargyl structure
|
Common Name | clodinafop-propargyl | ||
|---|---|---|---|---|
| CAS Number | 105512-06-9 | Molecular Weight | 349.741 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 432.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H13ClFNO4 | Melting Point | 48-57ºC | |
| MSDS | Chinese USA | Flash Point | 215.5±28.7 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of clodinafop-propargylClodinafop-propargyl, a main member of aryloxyphenoxy-propionate herbicides, is used for postemergence control of annual grasses in cereals, including Avena, Lolium, Setaria, Phalaris and Alopecurus spp[1]. |
| Name | clodinafop-propargyl |
|---|---|
| Synonym | More Synonyms |
| Description | Clodinafop-propargyl, a main member of aryloxyphenoxy-propionate herbicides, is used for postemergence control of annual grasses in cereals, including Avena, Lolium, Setaria, Phalaris and Alopecurus spp[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.7±45.0 °C at 760 mmHg |
| Melting Point | 48-57ºC |
| Molecular Formula | C17H13ClFNO4 |
| Molecular Weight | 349.741 |
| Flash Point | 215.5±28.7 °C |
| Exact Mass | 349.051727 |
| PSA | 57.65000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | JBDHZKLJNAIJNC-LLVKDONJSA-N |
| SMILES | C#CCOC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2F)cc1 |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H332-H317-H373-H410 |
| Precautionary Statements | P261-P273-P280-P304 + P340 + P312-P333 + P313-P391 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R20/22;R43;R50/53 |
| Safety Phrases | S36/37-S60-S61 |
| RIDADR | UN 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| Clodinafop Propargyl |
| 2-Propyn-1-yl (2R)-2-[4-[(5-Chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
| T6NJ BOR DOY1&VO2UU1& CF EG &&R Form |
| prop-2-ynyl (R)-2-[4-(5-chloro-3-fluoro-2-pyridyloxy)phenoxy]propionate |
| (R)-2-[4-[(5-Chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid 2-propynyl ester |
| 2-propynyl (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
| MFCD01632328 |
| clodinafop-propargyl |
| 2-Propyn-1-yl (2R)-2-{4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy}propanoate |
| Prop-2-yn-1-yl (2R)-2-{4-[(5-chloro-3-fluoropyridin-2-yl)oxy]phenoxy}propanoate |
| Propanoic acid, 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]-, 2-propyn-1-yl ester, (2R)- |