Z-FF-FMK
Modify Date: 2025-08-25 13:37:17
Z-FF-FMK structure
|
Common Name | Z-FF-FMK | ||
|---|---|---|---|---|
| CAS Number | 105608-85-3 | Molecular Weight | 462.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-FF-FMKZ-FF-FMK is a cell-permeant and irreversible inhibitor of cathepsin B and cathepsin L. |
| Name | Z-FF-FMK |
|---|
| Description | Z-FF-FMK is a cell-permeant and irreversible inhibitor of cathepsin B and cathepsin L. |
|---|
| Molecular Formula | C27H27FN2O4 |
|---|---|
| Molecular Weight | 462.52 |
| InChIKey | CAILNONEKASNSH-ZEQRLZLVSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)CF)OCc1ccccc1 |