Z-LLY-FMK structure
|
Common Name | Z-LLY-FMK | ||
|---|---|---|---|---|
| CAS Number | 133410-84-1 | Molecular Weight | 557.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H40FN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-LLY-FMKZ-LLY-FMK (Calpain Inhibitor IV) is a calpain inhibitor, involved in apoptosis of many cell systems. Z-LLY-FMK inhibits the intestine apoptosis after common bile duct ligation[1]. |
| Name | benzyl N-[1-[[1-[[4-fluoro-1-(4-hydroxyphenyl)-3-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-LLY-FMK (Calpain Inhibitor IV) is a calpain inhibitor, involved in apoptosis of many cell systems. Z-LLY-FMK inhibits the intestine apoptosis after common bile duct ligation[1]. |
|---|---|
| Related Catalog | |
| Target |
Calpain[1] |
| References |
| Molecular Formula | C30H40FN3O6 |
|---|---|
| Molecular Weight | 557.65 |
| Exact Mass | 557.29000 |
| PSA | 144.30000 |
| LogP | 5.71510 |
| InChIKey | JCRSHQCFRMCMOC-GSDHBNRESA-N |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccc(O)cc1)C(=O)CF |
| Calpain Inhibitor IV |
| Z-Leu-Leu-Tyr-Fluoromethylketone |
| Z-LLY-FMK |
| Z-Leu-Leu-Tyr-FMK |
| IN1508 |
| benzyl N-[(2S)-1-[[(2S)-1-[[(2S)-4-fluoro-1-(4-hydroxyphenyl)-3-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| FK017 |