(3S,4R)-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine structure
|
Common Name | (3S,4R)-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 105812-81-5 | Molecular Weight | 223.286 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 300.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H18FNO | Melting Point | 97-101ºC | |
| MSDS | USA | Flash Point | 135.4±27.9 °C | |
| Name | (3S,4R)-4-(4-Fluorophenyl)-3-Hydroxymethyl-1-Methylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.3±42.0 °C at 760 mmHg |
| Melting Point | 97-101ºC |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.286 |
| Flash Point | 135.4±27.9 °C |
| Exact Mass | 223.137238 |
| PSA | 23.47000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | CXRHUYYZISIIMT-AAEUAGOBSA-N |
| SMILES | CN1CCC(c2ccc(F)cc2)C(CO)C1 |
| Hazard Codes | Xn:Harmful |
|---|---|
| Risk Phrases | R22;R41;R51/53 |
| Safety Phrases | S22-S26-S39-S61 |
| RIDADR | UN3077 |
| Packaging Group | III |
| Hazard Class | 9 |
| HS Code | 2933399090 |
|
~77%
(3S,4R)-4-(4-Fl... CAS#:105812-81-5 |
| Literature: WO2004/5254 A1, ; Page 9 ; |
|
~81%
(3S,4R)-4-(4-Fl... CAS#:105812-81-5 |
| Literature: Tetrahedron Asymmetry, , vol. 22, # 1 p. 1 - 3 |
|
~%
(3S,4R)-4-(4-Fl... CAS#:105812-81-5 |
| Literature: WO2005/63707 A1, ; Page 30 ; |
|
~%
(3S,4R)-4-(4-Fl... CAS#:105812-81-5 |
| Literature: Tetrahedron Asymmetry, , vol. 22, # 1 p. 1 - 3 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinemethanol |
| [(3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinyl]methanol |
| (3S,4R)-4-(4′-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| (3S,4R)-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| EINECS 406-030-4 |
| MFCD06658161 |
| UNII:QRA30YT0AV |
| (-)-trans-4-(4-Fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
| (3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| trans-(-)-4-FLUOROPHENYL)-1; -METHYL-3-PIPERIDINE METHANOL |
| [(3S,4R)-4-(4-Fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| 3-Piperidinemethanol, 4-(4-fluorophenyl)-1-methyl-, (3S,4R)- |
| Paroxetine Impurity 11 |