2,2'-ethylenedioxydiethyl dioctanoate structure
|
Common Name | 2,2'-ethylenedioxydiethyl dioctanoate | ||
|---|---|---|---|---|
| CAS Number | 106-10-5 | Molecular Weight | 402.56500 | |
| Density | 0.978g/cm3 | Boiling Point | 471.1ºC at 760mmHg | |
| Molecular Formula | C22H42O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | Octanoic acid, diester with triethylene glycol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978g/cm3 |
|---|---|
| Boiling Point | 471.1ºC at 760mmHg |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.56500 |
| Flash Point | 198.2ºC |
| Exact Mass | 402.29800 |
| PSA | 71.06000 |
| LogP | 4.82700 |
| Vapour Pressure | 4.77E-09mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | YJGHMLJGPSVSLF-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCOCCOCCOC(=O)CCCCCCC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
2,2'-ethylenedi... CAS#:106-10-5 |
| Literature: Kogyo Kagaku Zasshi, , vol. 56, p. 945,946 Chem.Abstr., , p. 6904 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 203-361-4 |
| triethylene glycol dioctanoate |
| triethylene glycol dicaprylate |
| 2,2'-ethylenedioxydiethyl dioctanoate |