U27391 structure
|
Common Name | U27391 | ||
|---|---|---|---|---|
| CAS Number | 106314-87-8 | Molecular Weight | 448.55600 | |
| Density | 1.156g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H36N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of U27391U27391 is a metalloproteinase inhibitor. U27391 inhibits rhIL-1β Induced proteoglycan loss[1]. |
| Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|
| Description | U27391 is a metalloproteinase inhibitor. U27391 inhibits rhIL-1β Induced proteoglycan loss[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.156g/cm3 |
|---|---|
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.55600 |
| Exact Mass | 448.26900 |
| PSA | 162.08000 |
| LogP | 4.95850 |
| Index of Refraction | 1.536 |
| InChIKey | HLSQLCOADIMQBK-MNNMKWMVSA-N |
| SMILES | CC(C)CC(CC(=O)NO)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(N)=O |