Hydroxy Bosentan-d4 structure
|
Common Name | Hydroxy Bosentan-d4 | ||
|---|---|---|---|---|
| CAS Number | 1065472-91-4 | Molecular Weight | 571.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H25D4N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hydroxy Bosentan-d4Hydroxy Bosentan-d4 is deuterium labeled Hydroxy bosentan. Hydroxy bosentan (Ro 48-5033) is a primary metabolite of Bosentan (BOS) metabolized by the cytochrome P450 system in the liver. Ro 48-5033 assists BOS pharmacologically, retaining 10%-20% activities[1]. |
| Name | 4-(1-hydroxy-2-methylpropan-2-yl)-N-[5-(2-methoxyphenoxy)-2-pyrimidin-2-yl-6-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy Bosentan-d4 is deuterium labeled Hydroxy bosentan. Hydroxy bosentan (Ro 48-5033) is a primary metabolite of Bosentan (BOS) metabolized by the cytochrome P450 system in the liver. Ro 48-5033 assists BOS pharmacologically, retaining 10%-20% activities[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C27H25D4N5O7S |
|---|---|
| Molecular Weight | 571.64 |
| Exact Mass | 571.20400 |
| PSA | 174.26000 |
| LogP | 4.33010 |
| InChIKey | FAJQMBCLPZWTQJ-ONNKGWAKSA-N |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)CO)cc2)nc(-c2ncccn2)nc1OCCO |
| Ro 48-8634-d4 |
| Hydroxy Bosentan-d4 |
| Ro 48-5033-d4 |