n-(4-ethoxyphenyl)maleamic acid structure
|
Common Name | n-(4-ethoxyphenyl)maleamic acid | ||
|---|---|---|---|---|
| CAS Number | 108087-84-9 | Molecular Weight | 235.23600 | |
| Density | N/A | Boiling Point | 476.7ºC at 760mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | n-(4-ethoxyphenyl)maleamic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 476.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 242.1ºC |
| Exact Mass | 235.08400 |
| PSA | 75.63000 |
| LogP | 1.73760 |
| Vapour Pressure | 6.81E-10mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | LMTIUWRMRAZPEN-FPLPWBNLSA-N |
| SMILES | CCOc1ccc(NC(=O)C=CC(=O)O)cc1 |
|
~%
n-(4-ethoxyphen... CAS#:108087-84-9 |
| Literature: Atti della Accademia Nazionale dei Lincei, Classe di Scienze Fisiche, Matematiche e Naturali, Rendiconti, , vol. <5>18II, p. 316,326 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00020477 |
| Maleinsaeure-mono-p-phenetidid |
| Maleinsaeure-mono-p-ethoxy-anilid |