Tetraethyleneglycol dimethacrylate structure
|
Common Name | Tetraethyleneglycol dimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 109-17-1 | Molecular Weight | 330.373 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 409.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H26O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 176.4±24.6 °C | |
| Name | Tetraethylene glycol dimethacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.2±30.0 °C at 760 mmHg |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.373 |
| Flash Point | 176.4±24.6 °C |
| Exact Mass | 330.167847 |
| PSA | 80.29000 |
| LogP | 1.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | LTHJXDSHSVNJKG-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCOC(=O)C(=C)C |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S23-S24/25 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| RTECS | OZ4000000 |
| HS Code | 2918990090 |
|
~%
Tetraethylenegl... CAS#:109-17-1 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 194 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Polymeric nanocarriers for siRNA delivery to murine macrophages.
Macromol. Biosci. 14(8) , 1096-105, (2014) This work investigates the interactions of a polycationic nanocarrier with siRNA and with cells in order to better understand the capabilities and limitations of the carrier. The polycationic nanocarr... |
|
|
Construction of monomer-free, highly crosslinked, water-compatible polymers.
J. Dent. Res. 93(12) , 1326-31, (2014) Polymeric dental adhesives require the formation of densely crosslinked network structures to best ensure mechanical strength and durability in clinical service. Monomeric precursors to these material... |
|
|
Polymethacrylate monolithic columns for hydrophilic interaction liquid chromatography prepared using a secondary surface polymerization.
J. Chromatogr. A. 1402 , 82-93, (2015) Zwitterionic methacrylate based polymeric monolithic columns were prepared in two-step polymerizations, with reduced polymerization times. Characteristic properties such as hydrodynamic permeability, ... |
| 2-propenoic acid, 2-methyl-, 3,6,9-trioxaundecane-1,11-diyl ester |
| Oxybis(2,1-ethanediyloxy-2,1-ethanediyl) bis(2-methylacrylate) |
| 3,6,9-Trioxaundecamethylene dimetha |
| EINECS 203-653-1 |
| Tetraethyleneglycoldimethacrylat |
| Tetraethylene Glycol Dimethactrylate |
| MFCD00014932 |
| tgm4 |
| 2-Propenoic acid, 2-methyl-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester |
| teegdma |
| 3,6,9-Trioxaundecamethylendimethacrylat |
| PEG-4 DIMETHACRYLATE |
| ((Oxybis(ethane-2,1-diyl))bis(oxy))bis(ethane-2,1-diyl) bis(2-methylacrylate) |
| 14-methyl-13-oxo-3,6,9,12-tetraoxapentadec-14-en-1-yl 2-methylprop-2-enoate |
| sr209 |
| Tetraethyleneglycol dimethacrylate |
| polyethylene glycol dimethacrylate |
| 14-Methyl-13-oxo-3,6,9,12-tetraoxapentadec-14-en-1-yl methacrylate |
| triethyleneglycol dimethacrylate |
| Tetraethylene glycol dimethacrylate |
| TEGdimethacrylat |