Fmoc-L-Orn(N3)-OH structure
|
Common Name | Fmoc-L-Orn(N3)-OH | ||
|---|---|---|---|---|
| CAS Number | 1097192-04-5 | Molecular Weight | 380.397 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N4O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-5-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20N4O4 |
|---|---|
| Molecular Weight | 380.397 |
| Exact Mass | 380.148468 |
| PSA | 128.87000 |
| LogP | 4.12 |
| InChIKey | TVPIDQLSARDIPX-SFHVURJKSA-N |
| SMILES | [N-]=[N+]=NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
~87%
Fmoc-L-Orn(N3)-OH CAS#:1097192-04-5 |
| Literature: Holland-Nell, Kai; Meldal, Morten Angewandte Chemie - International Edition, 2011 , vol. 50, # 22 p. 5204 - 5206 |
|
~%
Fmoc-L-Orn(N3)-OH CAS#:1097192-04-5 |
| Literature: Isaad, Alexandra Le Chevalier; Barbetti, Francesca; Rovero, Paolo; D'Ursi, Anna Maria; Chelli, Mario; Chorev, Michael; Papini, Anna Maria European Journal of Organic Chemistry, 2008 , # 31 p. 5308 - 5314 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-norvaline |
| L-Norvaline, 5-azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-5-azido-L-norvaline |
| 5-azido-2S-{[(9H-fluorenyl-9-ylmethoxy)carbonyl]amino}pentanoic acid |
| Fmoc-L-|A-azidoornithine |
| (S)-5-Azido-2-(Fmoc-amino)pentanoic acid |
| Fmoc-Orn(N3)-OH |
| Fmoc-Orn(N2)-OH |
| (2S)-N-Fmoc-5-azido- pentenoic acid |