ASP3026 structure
|
Common Name | ASP3026 | ||
|---|---|---|---|---|
| CAS Number | 1097917-15-1 | Molecular Weight | 580.745 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 794.3±70.0 °C at 760 mmHg | |
| Molecular Formula | C29H40N8O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 434.2±35.7 °C | |
Use of ASP3026ASP3026 is a novel and selective inhibitor for ALK (anaplastic lymphoma kinase) with IC50 of 3.5 nM. |
| Name | 2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(2-propan-2-ylsulfonylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Description | ASP3026 is a novel and selective inhibitor for ALK (anaplastic lymphoma kinase) with IC50 of 3.5 nM. |
|---|---|
| Related Catalog | |
| References |
[1]. Sadao Kuromitsu, et al. AACR 102nd Annual Meeting, 2011. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 794.3±70.0 °C at 760 mmHg |
| Molecular Formula | C29H40N8O3S |
| Molecular Weight | 580.745 |
| Flash Point | 434.2±35.7 °C |
| Exact Mass | 580.294434 |
| PSA | 127.43000 |
| LogP | 1.01 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | MGGBYMDAPCCKCT-UHFFFAOYSA-N |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncnc(Nc2ccccc2S(=O)(=O)C(C)C)n1 |
| Storage condition | -20°C |
|
~85%
ASP3026 CAS#:1097917-15-1 |
| Literature: Astellas Pharma Inc.; OBITSU, Kazuyoshi; AKIBA, Takahiro; KOBAYASHI, Koji; HIRASAWA, Shun; KONDOH, Yutaka; TAKEGUCHI, Kazuhiro; TAKAHAMA, Yuji; ORII, Ryoki Patent: EP2669281 A1, 2013 ; Location in patent: Paragraph 0059 ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
|
~%
ASP3026 CAS#:1097917-15-1 |
| Literature: EP2669281 A1, ; |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| N2-[2-Methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]-N4-[2-[(1-methylethyl)sulfonyl]phenyl]-1,3,5-triazine-2,4-diamine |
| cc-325 |
| QCR-144 |
| N-{2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl}-N'-[2-(propane-2-sulfonyl)phenyl]-1,3,5-triazine-2,4-diamine |
| ASP 3026 |
| N-[2-(isopropylsulfonyl)phenyl]-N'-{2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl}-1,3,5-triazine-2,4-diamine |
| 1,3,5-Triazine-2,4-diamine, N-[2-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]-N-[2-[(1-methylethyl)sulfonyl]phenyl]- |
| CS-0787 |
| UNII-HP4L6MXF10 |
| N-[2-(Isopropylsulfonyl)phenyl]-N'-{2-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl}-1,3,5-triazine-2,4-diamine |
| ASP3026 |