Ridogrel structure
|
Common Name | Ridogrel | ||
|---|---|---|---|---|
| CAS Number | 110140-89-1 | Molecular Weight | 366.33400 | |
| Density | 1.26g/cm3 | Boiling Point | 495.2ºC at 760mmHg | |
| Molecular Formula | C18H17F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
Use of RidogrelRidogrel (R 68070) is an orally active combined thromboxane A2 synthetase inhibitor and thromboxane A2/prostaglandin endoperoxide receptor blocker. Ridogrel is potent antiplatelet agent. Anti-inflammatory activities[1][2][3]. |
| Name | Pentanoic acid, 5-[[(E)-[3-pyridinyl[3-(trifluoromethyl)phenyl]methylene]amino]oxy] |
|---|---|
| Synonym | More Synonyms |
| Description | Ridogrel (R 68070) is an orally active combined thromboxane A2 synthetase inhibitor and thromboxane A2/prostaglandin endoperoxide receptor blocker. Ridogrel is potent antiplatelet agent. Anti-inflammatory activities[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | In rats, R 68 070 (1.25 mg/kg orally, -2 h) singly prolongs tail bleeding times as much as a combination of TXA2 synthetase inhibition (dazoxiben 10 mg/kg) and TXA2/prostaglandin endoperoxide receptor blockade (BM 13177 40 mg/kg). In dogs, the compound reduces coronary thrombosis induced by electrical damage (1.25 mg/kg i.v.) and prevents the evolution of occlusion/reperfusion-induced arrhythmias into ventricular fibrillation (2.5 mg/kg i.v.)[2. |
| References |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 495.2ºC at 760mmHg |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.33400 |
| Flash Point | 253.3ºC |
| Exact Mass | 366.11900 |
| PSA | 71.78000 |
| LogP | 4.12430 |
| Vapour Pressure | 1.26E-10mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | GLLPUTYLZIKEGF-HAVVHWLPSA-N |
| SMILES | O=C(O)CCCCON=C(c1cccnc1)c1cccc(C(F)(F)F)c1 |
|
~41%
Ridogrel CAS#:110140-89-1 |
| Literature: US4746671 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ridogrel |