H-D-Phg-Leu-OH structure
|
Common Name | H-D-Phg-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 110207-44-8 | Molecular Weight | 264.32000 | |
| Density | 1.164g/cm3 | Boiling Point | 501.3ºC at 760mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257ºC | |
| Name | (2S)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 501.3ºC at 760mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 257ºC |
| Exact Mass | 264.14700 |
| PSA | 92.42000 |
| LogP | 2.39310 |
| Vapour Pressure | 7.19E-11mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | VJLOKXWMVJSDFY-NWDGAFQWSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)c1ccccc1)C(=O)O |
|
~70%
H-D-Phg-Leu-OH CAS#:110207-44-8 |
| Literature: Khimiuk, Andrei Y.; Korennykh, Alexei V.; Van Langen, Luuk M.; Van Rantwijk, Fred; Sheldon, Roger A.; Svedas, Vytas K. Tetrahedron Asymmetry, 2003 , vol. 14, # 20 p. 3123 - 3128 |
|
~%
H-D-Phg-Leu-OH CAS#:110207-44-8 |
| Literature: Galunsky, Boris; Kasche, Volker Advanced Synthesis and Catalysis, 2002 , vol. 344, # 10 p. 1115 - 1119 |
| L-Leucine,N-(D-2-phenylglycyl) |
| R-Phg-S-Leu |
| D-phenylglycyl-L-leucine |
| Aminophenylacetylleucine |
| H-D-PHG-LEU-OH |