α,α,α'-Tris(4-hydroxyphenyl)-1-ethyl-4-isopropylbenzene structure
|
Common Name | α,α,α'-Tris(4-hydroxyphenyl)-1-ethyl-4-isopropylbenzene | ||
|---|---|---|---|---|
| CAS Number | 110726-28-8 | Molecular Weight | 424.531 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 623.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C29H28O3 | Melting Point | 225ºC | |
| MSDS | N/A | Flash Point | 272.6±24.7 °C | |
| Name | α,α,α'-Tris(4-hydroxyphenyl)-1-ethyl-4-isopropylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 623.1±50.0 °C at 760 mmHg |
| Melting Point | 225ºC |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.531 |
| Flash Point | 272.6±24.7 °C |
| Exact Mass | 424.203857 |
| PSA | 60.69000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | WXYSZTISEJBRHW-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(C(C)(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2907299090 |
|
~82%
α,α,α'-Tris(4-h... CAS#:110726-28-8 |
| Literature: HONSHU CHEMICAL INDUSTRY CO., LTD. Patent: US2012/108853 A1, 2012 ; Location in patent: Page/Page column 16-17 ; |
|
~%
α,α,α'-Tris(4-h... CAS#:110726-28-8 |
| Literature: US2012/108853 A1, ; Page/Page column 15 ; |
|
~%
α,α,α'-Tris(4-h... CAS#:110726-28-8 |
| Literature: US2012/108853 A1, ; |
|
~%
α,α,α'-Tris(4-h... CAS#:110726-28-8 |
| Literature: US2012/108853 A1, ; |
|
~%
α,α,α'-Tris(4-h... CAS#:110726-28-8 |
| Literature: US2012/108853 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]propan-2-yl]phenol |
| Phenol, 4,4'-[1-[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl]ethylidene]bis- |
| 4,4'-(1-(p-(4-Hydroxy-α,α-dimethylbenzyl)phenyl)ethylidene)diphenol |
| 4,4'-(1-(4-(2-(4-Hydroxyphenyl)propan-2-yl)phenyl)ethane-1,1-diyl)diphenol |
| 4,4'-[1-[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl]ethylidene]bisphenol |
| QR DX1&1&R DX1&R DQ&R DQ |
| ALPHA,ALPHA,ALPHA'-TRIS(4-HYDROXYPHENYL)-1-ETHYL-4-ISOPROPYLBENZENE |
| 4,4'-(1-{4-[2-(4-Hydroxyphenyl)propan-2-yl]phenyl}ethane-1,1-diyl)diphenol |
| 4-[4-[1,1-Bis(4-hydroxyphenyl)ethyl]]-α,α-dimethylbenzylphenol |
| 4,4'-(1-{4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl}-1,1-ethanediyl)diphenol |