diethyl 2-(2,4-dichlorophenyl)propanedioate structure
|
Common Name | diethyl 2-(2,4-dichlorophenyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 111544-93-5 | Molecular Weight | 305.15400 | |
| Density | 1.29g/cm3 | Boiling Point | 136-139/0.05mm | |
| Molecular Formula | C13H14Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.5ºC | |
| Name | diethyl 2-(2,4-dichlorophenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 136-139/0.05mm |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.15400 |
| Flash Point | 133.5ºC |
| Exact Mass | 304.02700 |
| PSA | 52.60000 |
| LogP | 3.20320 |
| Vapour Pressure | 2.54E-05mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | FIGCCTUCURBNIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc(Cl)cc1Cl |
| Hazard Codes | Xi:Irritant; |
|---|---|
| HS Code | 2918990090 |
|
~%
diethyl 2-(2,4-... CAS#:111544-93-5 |
| Literature: US2010/56820 A1, ; Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| TE6063 |
| OR0372 |
| diethyl 2,4-dichlorophenylmalonate |