diethyl 2-[[(2,4-dichlorophenyl)amino]methylidene]propanedioate structure
|
Common Name | diethyl 2-[[(2,4-dichlorophenyl)amino]methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 19056-81-6 | Molecular Weight | 332.17900 | |
| Density | 1.335g/cm3 | Boiling Point | 380.6ºC at 760 mmHg | |
| Molecular Formula | C14H15Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
| Name | diethyl 2-[(2,4-dichloroanilino)methylidene]propanedioate |
|---|
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 380.6ºC at 760 mmHg |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.17900 |
| Flash Point | 184ºC |
| Exact Mass | 331.03800 |
| PSA | 64.63000 |
| LogP | 3.48840 |
| Vapour Pressure | 5.39E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | SVIWITLJGLYULB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNc1ccc(Cl)cc1Cl)C(=O)OCC |
|
~%
diethyl 2-[[(2,... CAS#:19056-81-6 |
| Literature: Golub, Andriy G.; Yakovenko, Olexander Ya.; Bdzhola, Volodymyr G.; Sapelkin, Vladislav M.; Zien, Piotr; Yarmoluk, Sergiy M. Journal of Medicinal Chemistry, 2006 , vol. 49, # 22 p. 6443 - 6450 |
|
~%
diethyl 2-[[(2,... CAS#:19056-81-6 |
| Literature: Cui, Sheng-Feng; Ren, Yu; Zhang, Shao-Lin; Peng, Xin-Mei; Damu, Guri L.V.; Geng, Rong-Xia; Zhou, Cheng-He Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 11 p. 3267 - 3272 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |