Calcipotriol Impurity C structure
|
Common Name | Calcipotriol Impurity C | ||
|---|---|---|---|---|
| CAS Number | 113082-99-8 | Molecular Weight | 412.605 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 582.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H40O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6±24.7 °C | |
Use of Calcipotriol Impurity CCalcipotriol Impurity C is the impurity of Calcipotriol, Calcipotriol is a ligand of VDR-like receptors.Target: VDR |
| Name | (5E)-Calcipotriene |
|---|---|
| Synonym | More Synonyms |
| Description | Calcipotriol Impurity C is the impurity of Calcipotriol, Calcipotriol is a ligand of VDR-like receptors.Target: VDR |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.0±50.0 °C at 760 mmHg |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.605 |
| Flash Point | 250.6±24.7 °C |
| Exact Mass | 412.297760 |
| PSA | 60.69000 |
| LogP | 5.43 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | LWQQLNNNIPYSNX-LFDOYIGJSA-N |
| SMILES | C=C1C(=CC=C2CCCC3(C)C2CCC3C(C)C=CC(O)C2CC2)CC(O)CC1O |
| Storage condition | 2-8℃ |
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (1S,3R,5E,7E,22E,24S)-26,27-Cyclo-9,10-secocholesta-5,7,10,22-tetraene-1,3,24-triol |
| 5,6 Trans-Calcipotriol |
| 1,3-Cyclohexanediol, 5-[(2E)-2-[(1R,3aS,7aR)-1-[(1R,2E,4S)-4-cyclopropyl-4-hydroxy-1-methyl-2-buten-1-yl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-, (1R,3S,5E)- |
| Calcipotriol Impurity C |