Boc-L-Pyroglutamic acid benzyl ester structure
|
Common Name | Boc-L-Pyroglutamic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 113400-36-5 | Molecular Weight | 319.352 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 464.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C17H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.0±26.8 °C | |
| Name | 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.9±38.0 °C at 760 mmHg |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.352 |
| Flash Point | 235.0±26.8 °C |
| Exact Mass | 319.141968 |
| PSA | 72.91000 |
| LogP | 1.37 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | TZNBTMCEMLXYEM-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC1C(=O)OCc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933790090 |
|
~98%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Tetrahedron Letters, , vol. 43, # 19 p. 3499 - 3501 |
|
~95%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: EP1970377 A1, ; Page/Page column 55 ; |
|
~%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: WO2006/24501 A1, ; Page/Page column 41 ; WO 2006/024501 A1 |
|
~38%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Tetrahedron, , vol. 53, # 30 p. 10545 - 10554 |
|
~%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Organic Letters, , vol. 6, # 9 p. 1469 - 1471 |
|
~%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 15 p. 2819 - 2834 |
|
~%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Journal of the American Chemical Society, , vol. 123, # 39 p. 9706 - 9707 |
|
~%
Boc-L-Pyrogluta... CAS#:113400-36-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 15, # 10 p. 3474 - 3488 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 1,2-Pyrrolidinedicarboxylic acid,5-oxo-,1-(1,1-dimethylethyl)2-(phenylmethyl) ester,(S) |
| benzyl 1-(t-butoxycarbonyl)pyroglutamate |
| (S)-2-Benzyl 1-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate |
| 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| phenylmethyl (S)-1-(1,1-dimethylethoxycarbonyl)-5-oxopyrrolidine-2-carboxylate |
| Boc-L-Pyroglutamicacidbenzylester |
| 2-benzyl 1-tert-butyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) 2-(phenylmethyl) ester, (2S)- |
| 2-Benzyl 1-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| PYR294 |
| (2S)-benzyl N-(tert-butyloxycarbonyl)-pyroglutamate |
| benzyl (2S)-N-tert-butoxycarbonyl-pyroglutamate |
| Boc-L-Pyroglutamic acid benzyl ester |
| Boc-Pyr-OBzl |