3,5-Di-tert-butylphenol structure
|
Common Name | 3,5-Di-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 1138-52-9 | Molecular Weight | 206.324 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 276.7±9.0 °C at 760 mmHg | |
| Molecular Formula | C14H22O | Melting Point | 87-89 °C(lit.) | |
| MSDS | N/A | Flash Point | 127.2±7.2 °C | |
Use of 3,5-Di-tert-butylphenol3,5-Di-tert-butylphenol is an volatile organic compound with anti-biofilm and antifungal activities. 3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species (ROS). |
| Name | 3,5-Di-tert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Description | 3,5-Di-tert-butylphenol is an volatile organic compound with anti-biofilm and antifungal activities. 3,5-Di-tert-butylphenol induces accumulation of reactive oxygen species (ROS). |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.7±9.0 °C at 760 mmHg |
| Melting Point | 87-89 °C(lit.) |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.324 |
| Flash Point | 127.2±7.2 °C |
| Exact Mass | 206.167068 |
| PSA | 20.23000 |
| LogP | 4.86 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | ZDWSNKPLZUXBPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(O)cc(C(C)(C)C)c1 |
| Stability | Stable. Incompatible with bases, acid chlorides, acid anhydrides, oxidizing agents, brass, steel, copper, copper alloys. |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3077 |
| Packaging Group | III |
| Hazard Class | 9 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| 3,5-Bis(2-methyl-2-propanyl)phenol |
| 3,5-Di-tert-butylphenol |
| 3,5-ditert-butylphenol |
| MFCD00008829 |
| Phenol, 3,5-bis(1,1-dimethylethyl)- |
| EINECS 214-513-4 |