3 5-di-tert-butylphenyl trifluoromethan& structure
|
Common Name | 3 5-di-tert-butylphenyl trifluoromethan& | ||
|---|---|---|---|---|
| CAS Number | 155064-25-8 | Molecular Weight | 338.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21F3O3S | Melting Point | 24-29ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (3,5-ditert-butylphenyl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 24-29ºC(lit.) |
|---|---|
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.38600 |
| Flash Point | >230 °F |
| Exact Mass | 338.11600 |
| PSA | 51.75000 |
| LogP | 5.59080 |
| InChIKey | NMKZEDAODGHHEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)cc(C(C)(C)C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~99%
3 5-di-tert-but... CAS#:155064-25-8 |
| Literature: Zhou, Zhang-Lin; Li, Zhiyong Patent: US2008/269486 A1, 2008 ; Location in patent: Page/Page column 5 ; |
|
~98%
3 5-di-tert-but... CAS#:155064-25-8 |
| Literature: Alvarez, Rosana; Vega, M. Jesus; Kammerer, Sabrina; Rossin, Aurelie; Germain, Pierre; Gronemeyer, Hinrich; De Lera, Angel R. Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 24 p. 6117 - 6122 |
| 3,5-bis(1,1-dimethylethyl)phenyl trifluoromethanesulfonate |
| (3,5-di-tert-butylphenyl) trifluoromethanesulfonate |
| MFCD05664301 |
| Methanesulfonic acid,trifluoro-,3,5-bis(1,1-dimethylethyl)phenyl ester |
| 3,5-di-tert-butylphenyl triflate |