N-Boc-1-aminocyclobutanecarboxylic acid structure
|
Common Name | N-Boc-1-aminocyclobutanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 120728-10-1 | Molecular Weight | 215.246 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 362.1±21.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | 129-133 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.8±22.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Boc-1-aminocyclobutane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.1±21.0 °C at 760 mmHg |
| Melting Point | 129-133 °C(lit.) |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.246 |
| Flash Point | 172.8±22.1 °C |
| Exact Mass | 215.115753 |
| PSA | 75.63000 |
| LogP | 1.16 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | ROVVUKFHORPDSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CCC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~63%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Palacin, Serge; Chin, Donovan N.; Simanek, Eric E.; MacDonald, John C.; Whitesides, George M.; McBride, Mary T.; Palmore, G. Tayhas R. Journal of the American Chemical Society, 1997 , vol. 119, # 49 p. 11807 - 11816 |
|
~89%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Kim, June J.; Wood, Michael R. Synthetic Communications, 2004 , vol. 34, # 4 p. 607 - 613 |
|
~%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Journal of the American Chemical Society, , vol. 119, # 49 p. 11807 - 11816 |
|
~%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Synthetic Communications, , vol. 34, # 4 p. 607 - 613 |
|
~%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Synthetic Communications, , vol. 34, # 4 p. 607 - 613 |
|
~%
N-Boc-1-aminocy... CAS#:120728-10-1 |
| Literature: Synthetic Communications, , vol. 34, # 4 p. 607 - 613 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Boc-1-Aminocyclobutanecarboxylic acid |
| 1-[(tert-Butoxycarbonyl)amino]cyclobutanecarboxylic acid |
| MFCD02682623 |
| Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid |
| N-Boc-amino-1-cyclobutanecarboxylic acid |
| 1-(Boc-amino)cyclobutanecarboxylic Acid |
| 1-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid |
| 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |